C17H15F4NO3 — CID 1225337
(2S)-N-(2-ethoxyphenyl)-2-(2,3,5,6-tetrafluorophenoxy)propanamide (PubChem CID 1225337) has the molecular formula C17H15F4NO3 and a molecular weight of 357.30 g/mol. Its IUPAC name is (2S)-N-(2-ethoxyphenyl)-2-(2,3,5,6-tetrafluorophenoxy)propanamide.
| Compound Name | (2S)-N-(2-ethoxyphenyl)-2-(2,3,5,6-tetrafluorophenoxy)propanamide |
|---|---|
| PubChem CID | 1225337 |
| Molecular Formula | C17H15F4NO3 |
| Molecular Weight | 357.30 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | (2S)-N-(2-ethoxyphenyl)-2-(2,3,5,6-tetrafluorophenoxy)propanamide |
| SMILES | CCOc1ccccc1NC(=O)[C@H](C)Oc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C17H15F4NO3/c1-3-24-13-7-5-4-6-12(13)22-17(23)9(2)25-16-14(20)10(18)8-11(19)15(16)21/h4-9H,3H2,1-2H3,(H,22,23)/t9-/m0/s1 |
| InChIKey | SWWZVMPIMFRZIS-VIFPVBQESA-N |
| XLogP | 4.05 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.30 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|