C15H9Cl2F4NO2 — CID 5077504
N-(2,5-dichlorophenyl)-2-(2,3,5,6-tetrafluorophenoxy)propanamide (PubChem CID 5077504) has the molecular formula C15H9Cl2F4NO2 and a molecular weight of 382.14 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-2-(2,3,5,6-tetrafluorophenoxy)propanamide.
| Compound Name | N-(2,5-dichlorophenyl)-2-(2,3,5,6-tetrafluorophenoxy)propanamide |
|---|---|
| PubChem CID | 5077504 |
| Molecular Formula | C15H9Cl2F4NO2 |
| Molecular Weight | 382.14 g/mol |
| Exact Mass | 380.99 |
| IUPAC Name | N-(2,5-dichlorophenyl)-2-(2,3,5,6-tetrafluorophenoxy)propanamide |
| SMILES | CC(Oc1c(F)c(F)cc(F)c1F)C(=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C15H9Cl2F4NO2/c1-6(15(23)22-11-4-7(16)2-3-8(11)17)24-14-12(20)9(18)5-10(19)13(14)21/h2-6H,1H3,(H,22,23) |
| InChIKey | ATMBZNDIDAGMTF-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.14 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|