C10H17NO — CID 122535947
[4-(1-aminopropyl)cyclohexa-1,3-dien-1-yl]methanol (PubChem CID 122535947) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is [4-(1-aminopropyl)cyclohexa-1,3-dien-1-yl]methanol.
| Compound Name | [4-(1-aminopropyl)cyclohexa-1,3-dien-1-yl]methanol |
|---|---|
| PubChem CID | 122535947 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | [4-(1-aminopropyl)cyclohexa-1,3-dien-1-yl]methanol |
| SMILES | CCC(N)C1=CC=C(CO)CC1 |
| InChI | InChI=1S/C10H17NO/c1-2-10(11)9-5-3-8(7-12)4-6-9/h3,5,10,12H,2,4,6-7,11H2,1H3 |
| InChIKey | RZAHGGMJKURJAE-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |