C24H28N4O5S3 — CID 122536311
4-[3,4-bis(2-methoxyethoxy)phenyl]-6-propylsulfinyl-2-(1,3-thiazol-2-yl)thieno[2,3-d]pyrimidin-5-amine (PubChem CID 122536311) has the molecular formula C24H28N4O5S3 and a molecular weight of 548.71 g/mol. Its IUPAC name is 4-[3,4-bis(2-methoxyethoxy)phenyl]-6-propylsulfinyl-2-(1,3-thiazol-2-yl)thieno[2,3-d]pyrimidin-5-amine.
| Compound Name | 4-[3,4-bis(2-methoxyethoxy)phenyl]-6-propylsulfinyl-2-(1,3-thiazol-2-yl)thieno[2,3-d]pyrimidin-5-amine |
|---|---|
| PubChem CID | 122536311 |
| Molecular Formula | C24H28N4O5S3 |
| Molecular Weight | 548.71 g/mol |
| Exact Mass | 548.12 |
| IUPAC Name | 4-[3,4-bis(2-methoxyethoxy)phenyl]-6-propylsulfinyl-2-(1,3-thiazol-2-yl)thieno[2,3-d]pyrimidin-5-amine |
| SMILES | CCCS(=O)c1sc2nc(-c3nccs3)nc(-c3ccc(OCCOC)c(OCCOC)c3)c2c1N |
| InChI | InChI=1S/C24H28N4O5S3/c1-4-13-36(29)24-19(25)18-20(27-21(28-22(18)35-24)23-26-7-12-34-23)15-5-6-16(32-10-8-30-2)17(14-15)33-11-9-31-3/h5-7,12,14H,4,8-11,13,25H2,1-3H3 |
| InChIKey | GUOBSOZMBHIBAK-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 118.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.71 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|