C9H18O3S — CID 122537097
2-[1-(2-ethenylsulfanylethoxy)propan-2-yloxy]ethanol (PubChem CID 122537097) has the molecular formula C9H18O3S and a molecular weight of 206.31 g/mol. Its IUPAC name is 2-[1-(2-ethenylsulfanylethoxy)propan-2-yloxy]ethanol.
| Compound Name | 2-[1-(2-ethenylsulfanylethoxy)propan-2-yloxy]ethanol |
|---|---|
| PubChem CID | 122537097 |
| Molecular Formula | C9H18O3S |
| Molecular Weight | 206.31 g/mol |
| Exact Mass | 206.10 |
| IUPAC Name | 2-[1-(2-ethenylsulfanylethoxy)propan-2-yloxy]ethanol |
| SMILES | C=CSCCOCC(C)OCCO |
| InChI | InChI=1S/C9H18O3S/c1-3-13-7-6-11-8-9(2)12-5-4-10/h3,9-10H,1,4-8H2,2H3 |
| InChIKey | UZCHXXAEGQXPPM-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.31 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|