C17H13NO4 — CID 122537726
7-(2-oxopropoxy)-4-phenylpyrano[2,3-b]pyridin-2-one (PubChem CID 122537726) has the molecular formula C17H13NO4 and a molecular weight of 295.29 g/mol. Its IUPAC name is 7-(2-oxopropoxy)-4-phenylpyrano[2,3-b]pyridin-2-one.
| Compound Name | 7-(2-oxopropoxy)-4-phenylpyrano[2,3-b]pyridin-2-one |
|---|---|
| PubChem CID | 122537726 |
| Molecular Formula | C17H13NO4 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | 7-(2-oxopropoxy)-4-phenylpyrano[2,3-b]pyridin-2-one |
| SMILES | CC(=O)COc1ccc2c(-c3ccccc3)cc(=O)oc2n1 |
| InChI | InChI=1S/C17H13NO4/c1-11(19)10-21-15-8-7-13-14(12-5-3-2-4-6-12)9-16(20)22-17(13)18-15/h2-9H,10H2,1H3 |
| InChIKey | XWSNMCJKQIJABG-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |