C26H34N4O6 — CID 122538829
(2S)-2-[2-[2-(1,5-dimethyl-6-oxo-3-pyridinyl)-3-(oxan-4-ylmethyl)benzimidazol-5-yl]oxyethylamino]-3-hydroxybutanoic acid (PubChem CID 122538829) has the molecular formula C26H34N4O6 and a molecular weight of 498.58 g/mol. Its IUPAC name is (2S)-2-[2-[2-(1,5-dimethyl-6-oxo-3-pyridinyl)-3-(oxan-4-ylmethyl)benzimidazol-5-yl]oxyethylamino]-3-hydroxybutanoic acid.
| Compound Name | (2S)-2-[2-[2-(1,5-dimethyl-6-oxo-3-pyridinyl)-3-(oxan-4-ylmethyl)benzimidazol-5-yl]oxyethylamino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 122538829 |
| Molecular Formula | C26H34N4O6 |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.25 |
| IUPAC Name | (2S)-2-[2-[2-(1,5-dimethyl-6-oxo-3-pyridinyl)-3-(oxan-4-ylmethyl)benzimidazol-5-yl]oxyethylamino]-3-hydroxybutanoic acid |
| SMILES | Cc1cc(-c2nc3ccc(OCCN[C@H](C(=O)O)C(C)O)cc3n2CC2CCOCC2)cn(C)c1=O |
| InChI | InChI=1S/C26H34N4O6/c1-16-12-19(15-29(3)25(16)32)24-28-21-5-4-20(36-11-8-27-23(17(2)31)26(33)34)13-22(21)30(24)14-18-6-9-35-10-7-18/h4-5,12-13,15,17-18,23,27,31H,6-11,14H2,1-3H3,(H,33,34)/t17?,23-/m0/s1 |
| InChIKey | ZNGVJDZWYSJLAF-VXLWULRPSA-N |
| XLogP | 1.94 |
| TPSA | 127.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|