C30H40N4O6 — CID 138642545
oxolan-3-yl 2-[2-[2-(1,5-dimethyl-6-oxo-3-pyridinyl)-1-(oxan-4-ylmethyl)benzimidazol-5-yl]oxyethylamino]butanoate (PubChem CID 138642545) has the molecular formula C30H40N4O6 and a molecular weight of 552.67 g/mol. Its IUPAC name is oxolan-3-yl 2-[2-[2-(1,5-dimethyl-6-oxo-3-pyridinyl)-1-(oxan-4-ylmethyl)benzimidazol-5-yl]oxyethylamino]butanoate.
| Compound Name | oxolan-3-yl 2-[2-[2-(1,5-dimethyl-6-oxo-3-pyridinyl)-1-(oxan-4-ylmethyl)benzimidazol-5-yl]oxyethylamino]butanoate |
|---|---|
| PubChem CID | 138642545 |
| Molecular Formula | C30H40N4O6 |
| Molecular Weight | 552.67 g/mol |
| Exact Mass | 552.29 |
| IUPAC Name | oxolan-3-yl 2-[2-[2-(1,5-dimethyl-6-oxo-3-pyridinyl)-1-(oxan-4-ylmethyl)benzimidazol-5-yl]oxyethylamino]butanoate |
| SMILES | CCC(NCCOc1ccc2c(c1)nc(-c1cc(C)c(=O)n(C)c1)n2CC1CCOCC1)C(=O)OC1CCOC1 |
| InChI | InChI=1S/C30H40N4O6/c1-4-25(30(36)40-24-9-13-38-19-24)31-10-14-39-23-5-6-27-26(16-23)32-28(22-15-20(2)29(35)33(3)18-22)34(27)17-21-7-11-37-12-8-21/h5-6,15-16,18,21,24-25,31H,4,7-14,17,19H2,1-3H3 |
| InChIKey | GQPJEISSZBXWBT-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.67 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|