C17H15ClN4O3 — CID 122540246
11-chloro-12-(6-methoxy-3-pyridinyl)-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraene-3-carboxylic acid (PubChem CID 122540246) has the molecular formula C17H15ClN4O3 and a molecular weight of 358.79 g/mol. Its IUPAC name is 11-chloro-12-(6-methoxy-3-pyridinyl)-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraene-3-carboxylic acid.
| Compound Name | 11-chloro-12-(6-methoxy-3-pyridinyl)-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraene-3-carboxylic acid |
|---|---|
| PubChem CID | 122540246 |
| Molecular Formula | C17H15ClN4O3 |
| Molecular Weight | 358.79 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | 11-chloro-12-(6-methoxy-3-pyridinyl)-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraene-3-carboxylic acid |
| SMILES | COc1ccc(-c2cn3c4c(nc3cc2Cl)CCCN4C(=O)O)cn1 |
| InChI | InChI=1S/C17H15ClN4O3/c1-25-15-5-4-10(8-19-15)11-9-22-14(7-12(11)18)20-13-3-2-6-21(16(13)22)17(23)24/h4-5,7-9H,2-3,6H2,1H3,(H,23,24) |
| InChIKey | JPIWVJXLTILCMX-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 79.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.79 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |