C35H39Cl2N9O4 — CID 122540828
2-butan-2-yl-4-[4-[4-[5-[[2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]-2-pyridinyl]-3-methylpiperazin-1-yl]phenyl]-1,2,4-triazol-3-one (PubChem CID 122540828) has the molecular formula C35H39Cl2N9O4 and a molecular weight of 720.66 g/mol. Its IUPAC name is 2-butan-2-yl-4-[4-[4-[5-[[2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]-2-pyridinyl]-3-methylpiperazin-1-yl]phenyl]-1,2,4-triazol-3-one.
| Compound Name | 2-butan-2-yl-4-[4-[4-[5-[[2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]-2-pyridinyl]-3-methylpiperazin-1-yl]phenyl]-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 122540828 |
| Molecular Formula | C35H39Cl2N9O4 |
| Molecular Weight | 720.66 g/mol |
| Exact Mass | 719.25 |
| IUPAC Name | 2-butan-2-yl-4-[4-[4-[5-[[2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]-2-pyridinyl]-3-methylpiperazin-1-yl]phenyl]-1,2,4-triazol-3-one |
| SMILES | CCC(C)n1ncn(-c2ccc(N3CCN(c4ccc(OCC5COC(Cn6cncn6)(c6ccc(Cl)cc6Cl)O5)cn4)C(C)C3)cc2)c1=O |
| InChI | InChI=1S/C35H39Cl2N9O4/c1-4-24(2)46-34(47)45(23-41-46)28-8-6-27(7-9-28)42-13-14-44(25(3)17-42)33-12-10-29(16-39-33)48-18-30-19-49-35(50-30,20-43-22-38-21-40-43)31-11-5-26(36)15-32(31)37/h5-12,15-16,21-25,30H,4,13-14,17-20H2,1-3H3 |
| InChIKey | XHCFRTPHQMKYED-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 117.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.66 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|