C29H34Cl2N8O4 — CID 164852700
2-butan-2-yl-4-[4-[4-[[2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]piperazin-1-yl]phenyl]-1,2,4-triazol-3-one (PubChem CID 164852700) has the molecular formula C29H34Cl2N8O4 and a molecular weight of 629.55 g/mol. Its IUPAC name is 2-butan-2-yl-4-[4-[4-[[2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]piperazin-1-yl]phenyl]-1,2,4-triazol-3-one.
| Compound Name | 2-butan-2-yl-4-[4-[4-[[2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]piperazin-1-yl]phenyl]-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 164852700 |
| Molecular Formula | C29H34Cl2N8O4 |
| Molecular Weight | 629.55 g/mol |
| Exact Mass | 628.21 |
| IUPAC Name | 2-butan-2-yl-4-[4-[4-[[2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]piperazin-1-yl]phenyl]-1,2,4-triazol-3-one |
| SMILES | CCC(C)n1ncn(-c2ccc(N3CCN(OCC4COC(Cn5cncn5)(c5ccc(Cl)cc5Cl)O4)CC3)cc2)c1=O |
| InChI | InChI=1S/C29H34Cl2N8O4/c1-3-21(2)39-28(40)38(20-34-39)24-7-5-23(6-8-24)35-10-12-37(13-11-35)42-16-25-15-41-29(43-25,17-36-19-32-18-33-36)26-9-4-22(30)14-27(26)31/h4-9,14,18-21,25H,3,10-13,15-17H2,1-2H3 |
| InChIKey | PLPAQPJSKJMPAV-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 104.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.55 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|