C10H10FN3O2 — CID 122543623
5-fluoro-3-propan-2-yl-8H-pyrido[2,3-d]pyrimidine-2,7-dione (PubChem CID 122543623) has the molecular formula C10H10FN3O2 and a molecular weight of 223.21 g/mol. Its IUPAC name is 5-fluoro-3-propan-2-yl-8H-pyrido[2,3-d]pyrimidine-2,7-dione.
| Compound Name | 5-fluoro-3-propan-2-yl-8H-pyrido[2,3-d]pyrimidine-2,7-dione |
|---|---|
| PubChem CID | 122543623 |
| Molecular Formula | C10H10FN3O2 |
| Molecular Weight | 223.21 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | 5-fluoro-3-propan-2-yl-8H-pyrido[2,3-d]pyrimidine-2,7-dione |
| SMILES | CC(C)n1cc2c(F)cc(=O)[nH]c2nc1=O |
| InChI | InChI=1S/C10H10FN3O2/c1-5(2)14-4-6-7(11)3-8(15)12-9(6)13-10(14)16/h3-5H,1-2H3,(H,12,13,15,16) |
| InChIKey | VHWRQDGGCUFYMS-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.21 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |