C27H35NO8S — CID 122546565
(2R,4R,6R)-6-[(1R,2R)-1,2-dihydroxy-3-[(4-phenylbenzoyl)amino]propyl]-2-(3-ethylsulfanylpropoxy)-4-hydroxyoxane-2-carboxylic acid (PubChem CID 122546565) has the molecular formula C27H35NO8S and a molecular weight of 533.64 g/mol. Its IUPAC name is (2R,4R,6R)-6-[(1R,2R)-1,2-dihydroxy-3-[(4-phenylbenzoyl)amino]propyl]-2-(3-ethylsulfanylpropoxy)-4-hydroxyoxane-2-carboxylic acid.
| Compound Name | (2R,4R,6R)-6-[(1R,2R)-1,2-dihydroxy-3-[(4-phenylbenzoyl)amino]propyl]-2-(3-ethylsulfanylpropoxy)-4-hydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 122546565 |
| Molecular Formula | C27H35NO8S |
| Molecular Weight | 533.64 g/mol |
| Exact Mass | 533.21 |
| IUPAC Name | (2R,4R,6R)-6-[(1R,2R)-1,2-dihydroxy-3-[(4-phenylbenzoyl)amino]propyl]-2-(3-ethylsulfanylpropoxy)-4-hydroxyoxane-2-carboxylic acid |
| SMILES | CCSCCCO[C@]1(C(=O)O)C[C@H](O)C[C@H]([C@H](O)[C@H](O)CNC(=O)c2ccc(-c3ccccc3)cc2)O1 |
| InChI | InChI=1S/C27H35NO8S/c1-2-37-14-6-13-35-27(26(33)34)16-21(29)15-23(36-27)24(31)22(30)17-28-25(32)20-11-9-19(10-12-20)18-7-4-3-5-8-18/h3-5,7-12,21-24,29-31H,2,6,13-17H2,1H3,(H,28,32)(H,33,34)/t21-,22-,23-,24-,27-/m1/s1 |
| InChIKey | MJEOYZDKTMQTQG-XMPCBSOPSA-N |
| XLogP | 2.29 |
| TPSA | 145.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.64 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|