C15H25N5 — CID 122555876
N-[(1-ethyl-5-methylpyrazol-4-yl)methyl]-4-(2-methylimidazol-1-yl)butan-2-amine (PubChem CID 122555876) has the molecular formula C15H25N5 and a molecular weight of 275.40 g/mol. Its IUPAC name is N-[(1-ethyl-5-methylpyrazol-4-yl)methyl]-4-(2-methylimidazol-1-yl)butan-2-amine.
| Compound Name | N-[(1-ethyl-5-methylpyrazol-4-yl)methyl]-4-(2-methylimidazol-1-yl)butan-2-amine |
|---|---|
| PubChem CID | 122555876 |
| Molecular Formula | C15H25N5 |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.21 |
| IUPAC Name | N-[(1-ethyl-5-methylpyrazol-4-yl)methyl]-4-(2-methylimidazol-1-yl)butan-2-amine |
| SMILES | CCn1ncc(CNC(C)CCn2ccnc2C)c1C |
| InChI | InChI=1S/C15H25N5/c1-5-20-13(3)15(11-18-20)10-17-12(2)6-8-19-9-7-16-14(19)4/h7,9,11-12,17H,5-6,8,10H2,1-4H3 |
| InChIKey | AMOPVYZHOUXPGZ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 47.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |