C13H21N5 — CID 131916831
N-[2-(1H-imidazol-2-yl)ethyl]-4-(2-methylimidazol-1-yl)butan-2-amine (PubChem CID 131916831) has the molecular formula C13H21N5 and a molecular weight of 247.35 g/mol. Its IUPAC name is N-[2-(1H-imidazol-2-yl)ethyl]-4-(2-methylimidazol-1-yl)butan-2-amine.
| Compound Name | N-[2-(1H-imidazol-2-yl)ethyl]-4-(2-methylimidazol-1-yl)butan-2-amine |
|---|---|
| PubChem CID | 131916831 |
| Molecular Formula | C13H21N5 |
| Molecular Weight | 247.35 g/mol |
| Exact Mass | 247.18 |
| IUPAC Name | N-[2-(1H-imidazol-2-yl)ethyl]-4-(2-methylimidazol-1-yl)butan-2-amine |
| SMILES | Cc1nccn1CCC(C)NCCc1ncc[nH]1 |
| InChI | InChI=1S/C13H21N5/c1-11(4-9-18-10-8-15-12(18)2)14-5-3-13-16-6-7-17-13/h6-8,10-11,14H,3-5,9H2,1-2H3,(H,16,17) |
| InChIKey | KNZZNSHRQKBIEN-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.35 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |