C17H27N5O3 — CID 122556508
1-[[5-(cyclobutanecarbonyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-yl]methyl]-3-(3-methoxypropyl)urea (PubChem CID 122556508) has the molecular formula C17H27N5O3 and a molecular weight of 349.44 g/mol. Its IUPAC name is 1-[[5-(cyclobutanecarbonyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-yl]methyl]-3-(3-methoxypropyl)urea.
| Compound Name | 1-[[5-(cyclobutanecarbonyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-yl]methyl]-3-(3-methoxypropyl)urea |
|---|---|
| PubChem CID | 122556508 |
| Molecular Formula | C17H27N5O3 |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.21 |
| IUPAC Name | 1-[[5-(cyclobutanecarbonyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-yl]methyl]-3-(3-methoxypropyl)urea |
| SMILES | COCCCNC(=O)NCc1cc2n(n1)CCN(C(=O)C1CCC1)C2 |
| InChI | InChI=1S/C17H27N5O3/c1-25-9-3-6-18-17(24)19-11-14-10-15-12-21(7-8-22(15)20-14)16(23)13-4-2-5-13/h10,13H,2-9,11-12H2,1H3,(H2,18,19,24) |
| InChIKey | HITWMKBHQZXYDO-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|