C20H25N5O2 — CID 70741663
1-[[5-(cyclobutanecarbonyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl]methyl]-3-phenylurea (PubChem CID 70741663) has the molecular formula C20H25N5O2 and a molecular weight of 367.45 g/mol. Its IUPAC name is 1-[[5-(cyclobutanecarbonyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl]methyl]-3-phenylurea.
| Compound Name | 1-[[5-(cyclobutanecarbonyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl]methyl]-3-phenylurea |
|---|---|
| PubChem CID | 70741663 |
| Molecular Formula | C20H25N5O2 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | 1-[[5-(cyclobutanecarbonyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl]methyl]-3-phenylurea |
| SMILES | O=C(NCc1cc2n(n1)CCCN(C(=O)C1CCC1)C2)Nc1ccccc1 |
| InChI | InChI=1S/C20H25N5O2/c26-19(15-6-4-7-15)24-10-5-11-25-18(14-24)12-17(23-25)13-21-20(27)22-16-8-2-1-3-9-16/h1-3,8-9,12,15H,4-7,10-11,13-14H2,(H2,21,22,27) |
| InChIKey | ZVCQAFMQZUCMLO-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |