C17H22N6O — CID 70767265
cyclobutyl-[2-[(pyrimidin-2-ylamino)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]methanone (PubChem CID 70767265) has the molecular formula C17H22N6O and a molecular weight of 326.40 g/mol. Its IUPAC name is cyclobutyl-[2-[(pyrimidin-2-ylamino)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]methanone.
| Compound Name | cyclobutyl-[2-[(pyrimidin-2-ylamino)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]methanone |
|---|---|
| PubChem CID | 70767265 |
| Molecular Formula | C17H22N6O |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | cyclobutyl-[2-[(pyrimidin-2-ylamino)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]methanone |
| SMILES | O=C(C1CCC1)N1CCCn2nc(CNc3ncccn3)cc2C1 |
| InChI | InChI=1S/C17H22N6O/c24-16(13-4-1-5-13)22-8-3-9-23-15(12-22)10-14(21-23)11-20-17-18-6-2-7-19-17/h2,6-7,10,13H,1,3-5,8-9,11-12H2,(H,18,19,20) |
| InChIKey | YDQJCPITZJUMPN-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |