C16H31N3O2 — CID 122556586
1-[3-(3-hydroxypropyl)piperidin-1-yl]-2-[methyl(piperidin-4-yl)amino]ethanone (PubChem CID 122556586) has the molecular formula C16H31N3O2 and a molecular weight of 297.44 g/mol. Its IUPAC name is 1-[3-(3-hydroxypropyl)piperidin-1-yl]-2-[methyl(piperidin-4-yl)amino]ethanone.
| Compound Name | 1-[3-(3-hydroxypropyl)piperidin-1-yl]-2-[methyl(piperidin-4-yl)amino]ethanone |
|---|---|
| PubChem CID | 122556586 |
| Molecular Formula | C16H31N3O2 |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.24 |
| IUPAC Name | 1-[3-(3-hydroxypropyl)piperidin-1-yl]-2-[methyl(piperidin-4-yl)amino]ethanone |
| SMILES | CN(CC(=O)N1CCCC(CCCO)C1)C1CCNCC1 |
| InChI | InChI=1S/C16H31N3O2/c1-18(15-6-8-17-9-7-15)13-16(21)19-10-2-4-14(12-19)5-3-11-20/h14-15,17,20H,2-13H2,1H3 |
| InChIKey | XLCSAWQAQGTTEQ-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |