C16H29N3O3 — CID 156609504
1-(5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-2-[methyl(piperidin-4-yl)amino]ethanone (PubChem CID 156609504) has the molecular formula C16H29N3O3 and a molecular weight of 311.43 g/mol. Its IUPAC name is 1-(5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-2-[methyl(piperidin-4-yl)amino]ethanone.
| Compound Name | 1-(5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-2-[methyl(piperidin-4-yl)amino]ethanone |
|---|---|
| PubChem CID | 156609504 |
| Molecular Formula | C16H29N3O3 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.22 |
| IUPAC Name | 1-(5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-2-[methyl(piperidin-4-yl)amino]ethanone |
| SMILES | CN(CC(=O)N1CC2CC(O)C(O)CC2C1)C1CCNCC1 |
| InChI | InChI=1S/C16H29N3O3/c1-18(13-2-4-17-5-3-13)10-16(22)19-8-11-6-14(20)15(21)7-12(11)9-19/h11-15,17,20-21H,2-10H2,1H3 |
| InChIKey | CZQQWWSZLJEAIQ-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 76.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |