C19H27N3O4 — CID 122556803
4-[(4-methoxyphenoxy)methyl]-N-(2-oxopiperidin-3-yl)piperidine-1-carboxamide (PubChem CID 122556803) has the molecular formula C19H27N3O4 and a molecular weight of 361.44 g/mol. Its IUPAC name is 4-[(4-methoxyphenoxy)methyl]-N-(2-oxopiperidin-3-yl)piperidine-1-carboxamide.
| Compound Name | 4-[(4-methoxyphenoxy)methyl]-N-(2-oxopiperidin-3-yl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 122556803 |
| Molecular Formula | C19H27N3O4 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | 4-[(4-methoxyphenoxy)methyl]-N-(2-oxopiperidin-3-yl)piperidine-1-carboxamide |
| SMILES | COc1ccc(OCC2CCN(C(=O)NC3CCCNC3=O)CC2)cc1 |
| InChI | InChI=1S/C19H27N3O4/c1-25-15-4-6-16(7-5-15)26-13-14-8-11-22(12-9-14)19(24)21-17-3-2-10-20-18(17)23/h4-7,14,17H,2-3,8-13H2,1H3,(H,20,23)(H,21,24) |
| InChIKey | OHIGNNAQLACCNW-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |