C18H24N4O4 — CID 7682216
(2R)-4-(4-methoxybenzoyl)-N-[(3S)-2-oxopiperidin-3-yl]piperazine-2-carboxamide (PubChem CID 7682216) has the molecular formula C18H24N4O4 and a molecular weight of 360.41 g/mol. Its IUPAC name is (2R)-4-(4-methoxybenzoyl)-N-[(3S)-2-oxopiperidin-3-yl]piperazine-2-carboxamide.
| Compound Name | (2R)-4-(4-methoxybenzoyl)-N-[(3S)-2-oxopiperidin-3-yl]piperazine-2-carboxamide |
|---|---|
| PubChem CID | 7682216 |
| Molecular Formula | C18H24N4O4 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | (2R)-4-(4-methoxybenzoyl)-N-[(3S)-2-oxopiperidin-3-yl]piperazine-2-carboxamide |
| SMILES | COc1ccc(C(=O)N2CCN[C@@H](C(=O)N[C@H]3CCCNC3=O)C2)cc1 |
| InChI | InChI=1S/C18H24N4O4/c1-26-13-6-4-12(5-7-13)18(25)22-10-9-19-15(11-22)17(24)21-14-3-2-8-20-16(14)23/h4-7,14-15,19H,2-3,8-11H2,1H3,(H,20,23)(H,21,24)/t14-,15+/m0/s1 |
| InChIKey | SJXPQLLJGVOMCJ-LSDHHAIUSA-N |
| XLogP | -0.50 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |