C15H25N5O4 — CID 7682222
(2R)-4-(morpholine-4-carbonyl)-N-[(3S)-2-oxopiperidin-3-yl]piperazine-2-carboxamide (PubChem CID 7682222) has the molecular formula C15H25N5O4 and a molecular weight of 339.40 g/mol. Its IUPAC name is (2R)-4-(morpholine-4-carbonyl)-N-[(3S)-2-oxopiperidin-3-yl]piperazine-2-carboxamide.
| Compound Name | (2R)-4-(morpholine-4-carbonyl)-N-[(3S)-2-oxopiperidin-3-yl]piperazine-2-carboxamide |
|---|---|
| PubChem CID | 7682222 |
| Molecular Formula | C15H25N5O4 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | (2R)-4-(morpholine-4-carbonyl)-N-[(3S)-2-oxopiperidin-3-yl]piperazine-2-carboxamide |
| SMILES | O=C1NCCC[C@@H]1NC(=O)[C@H]1CN(C(=O)N2CCOCC2)CCN1 |
| InChI | InChI=1S/C15H25N5O4/c21-13-11(2-1-3-17-13)18-14(22)12-10-20(5-4-16-12)15(23)19-6-8-24-9-7-19/h11-12,16H,1-10H2,(H,17,21)(H,18,22)/t11-,12+/m0/s1 |
| InChIKey | QKMDYBWVXUPIGA-NWDGAFQWSA-N |
| XLogP | -1.89 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |