C13H22N4O4 — CID 9423832
(2S)-4-(2-methoxyacetyl)-N-[(3S)-2-oxopiperidin-3-yl]piperazine-2-carboxamide (PubChem CID 9423832) has the molecular formula C13H22N4O4 and a molecular weight of 298.34 g/mol. Its IUPAC name is (2S)-4-(2-methoxyacetyl)-N-[(3S)-2-oxopiperidin-3-yl]piperazine-2-carboxamide.
| Compound Name | (2S)-4-(2-methoxyacetyl)-N-[(3S)-2-oxopiperidin-3-yl]piperazine-2-carboxamide |
|---|---|
| PubChem CID | 9423832 |
| Molecular Formula | C13H22N4O4 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | (2S)-4-(2-methoxyacetyl)-N-[(3S)-2-oxopiperidin-3-yl]piperazine-2-carboxamide |
| SMILES | COCC(=O)N1CCN[C@H](C(=O)N[C@H]2CCCNC2=O)C1 |
| InChI | InChI=1S/C13H22N4O4/c1-21-8-11(18)17-6-5-14-10(7-17)13(20)16-9-3-2-4-15-12(9)19/h9-10,14H,2-8H2,1H3,(H,15,19)(H,16,20)/t9-,10-/m0/s1 |
| InChIKey | RKWWSBMMYOKJIN-UWVGGRQHSA-N |
| XLogP | -2.17 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | -2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |