C15H24N4O5 — CID 78524418
4-acetyl-1-(2-methoxyacetyl)-N-(2-oxopiperidin-3-yl)piperazine-2-carboxamide (PubChem CID 78524418) has the molecular formula C15H24N4O5 and a molecular weight of 340.38 g/mol. Its IUPAC name is 4-acetyl-1-(2-methoxyacetyl)-N-(2-oxopiperidin-3-yl)piperazine-2-carboxamide.
| Compound Name | 4-acetyl-1-(2-methoxyacetyl)-N-(2-oxopiperidin-3-yl)piperazine-2-carboxamide |
|---|---|
| PubChem CID | 78524418 |
| Molecular Formula | C15H24N4O5 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | 4-acetyl-1-(2-methoxyacetyl)-N-(2-oxopiperidin-3-yl)piperazine-2-carboxamide |
| SMILES | COCC(=O)N1CCN(C(C)=O)CC1C(=O)NC1CCCNC1=O |
| InChI | InChI=1S/C15H24N4O5/c1-10(20)18-6-7-19(13(21)9-24-2)12(8-18)15(23)17-11-4-3-5-16-14(11)22/h11-12H,3-9H2,1-2H3,(H,16,22)(H,17,23) |
| InChIKey | HIKHYKQBWXLKJE-UHFFFAOYSA-N |
| XLogP | -1.91 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |