C17H29N3OS — CID 122557239
3-[3-[ethyl(methyl)amino]butyl]-1-methyl-1-[(3-methylsulfanylphenyl)methyl]urea (PubChem CID 122557239) has the molecular formula C17H29N3OS and a molecular weight of 323.51 g/mol. Its IUPAC name is 3-[3-[ethyl(methyl)amino]butyl]-1-methyl-1-[(3-methylsulfanylphenyl)methyl]urea.
| Compound Name | 3-[3-[ethyl(methyl)amino]butyl]-1-methyl-1-[(3-methylsulfanylphenyl)methyl]urea |
|---|---|
| PubChem CID | 122557239 |
| Molecular Formula | C17H29N3OS |
| Molecular Weight | 323.51 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | 3-[3-[ethyl(methyl)amino]butyl]-1-methyl-1-[(3-methylsulfanylphenyl)methyl]urea |
| SMILES | CCN(C)C(C)CCNC(=O)N(C)Cc1cccc(SC)c1 |
| InChI | InChI=1S/C17H29N3OS/c1-6-19(3)14(2)10-11-18-17(21)20(4)13-15-8-7-9-16(12-15)22-5/h7-9,12,14H,6,10-11,13H2,1-5H3,(H,18,21) |
| InChIKey | ZQMPBUAZJVJRIL-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.51 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |