C17H27N3OS — CID 125437297
3-[(3S)-1-ethylpiperidin-3-yl]-1-methyl-1-[(3-methylsulfanylphenyl)methyl]urea (PubChem CID 125437297) has the molecular formula C17H27N3OS and a molecular weight of 321.49 g/mol. Its IUPAC name is 3-[(3S)-1-ethylpiperidin-3-yl]-1-methyl-1-[(3-methylsulfanylphenyl)methyl]urea.
| Compound Name | 3-[(3S)-1-ethylpiperidin-3-yl]-1-methyl-1-[(3-methylsulfanylphenyl)methyl]urea |
|---|---|
| PubChem CID | 125437297 |
| Molecular Formula | C17H27N3OS |
| Molecular Weight | 321.49 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | 3-[(3S)-1-ethylpiperidin-3-yl]-1-methyl-1-[(3-methylsulfanylphenyl)methyl]urea |
| SMILES | CCN1CCC[C@H](NC(=O)N(C)Cc2cccc(SC)c2)C1 |
| InChI | InChI=1S/C17H27N3OS/c1-4-20-10-6-8-15(13-20)18-17(21)19(2)12-14-7-5-9-16(11-14)22-3/h5,7,9,11,15H,4,6,8,10,12-13H2,1-3H3,(H,18,21)/t15-/m0/s1 |
| InChIKey | LARIFUAQBXQJNR-HNNXBMFYSA-N |
| XLogP | 3.03 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.49 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |