About 4-cyano-N-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]-1H-pyrrole-2-carboxamide
4-cyano-N-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]-1H-pyrrole-2-carboxamide (PubChem CID 122558978) has the molecular formula C13H14N4OS
and a molecular weight of 274.35 g/mol. Its IUPAC name is 4-cyano-N-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]-1H-pyrrole-2-carboxamide.
Molecular Properties
| Compound Name | 4-cyano-N-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]-1H-pyrrole-2-carboxamide |
| PubChem CID | 122558978 |
| Molecular Formula | C13H14N4OS |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 4-cyano-N-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]-1H-pyrrole-2-carboxamide |
| SMILES | CCc1nc(CCNC(=O)c2cc(C#N)c[nH]2)cs1 |
| InChI | InChI=1S/C13H14N4OS/c1-2-12-17-10(8-19-12)3-4-15-13(18)11-5-9(6-14)7-16-11/h5,7-8,16H,2-4H2,1H3,(H,15,18) |
| InChIKey | SLTOEHXNQCHAAE-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 81.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-cyano-N-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]-1H-pyrrole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyano-N-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]-1H-pyrrole-2-carboxamide?
The IUPAC name of 4-cyano-N-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]-1H-pyrrole-2-carboxamide (CID 122558978) is 4-cyano-N-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]-1H-pyrrole-2-carboxamide.
What is the SMILES notation for 4-cyano-N-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]-1H-pyrrole-2-carboxamide?
The canonical SMILES for 4-cyano-N-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]-1H-pyrrole-2-carboxamide is CCc1nc(CCNC(=O)c2cc(C#N)c[nH]2)cs1.
What is the InChIKey of 4-cyano-N-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]-1H-pyrrole-2-carboxamide?
The InChIKey is SLTOEHXNQCHAAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N4OS/c1-2-12-17-10(8-19-12)3-4-15-13(18)11-5-9(6-14)7-16-11/h5,7-8,16H,2-4H2,1H3,(H,15,18).
What are the key properties of 4-cyano-N-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]-1H-pyrrole-2-carboxamide?
4-cyano-N-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]-1H-pyrrole-2-carboxamide has a molecular weight of 274.35 g/mol, XLogP of 1.88, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyano-N-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]-1H-pyrrole-2-carboxamide is sourced from PubChem (CID 122558978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).