C22H24N4O2 — CID 122559172
N-(3,3-dimethyl-1-pyridin-3-ylbutyl)-3-(6-oxo-1H-pyrazin-2-yl)benzamide (PubChem CID 122559172) has the molecular formula C22H24N4O2 and a molecular weight of 376.46 g/mol. Its IUPAC name is N-(3,3-dimethyl-1-pyridin-3-ylbutyl)-3-(6-oxo-1H-pyrazin-2-yl)benzamide.
| Compound Name | N-(3,3-dimethyl-1-pyridin-3-ylbutyl)-3-(6-oxo-1H-pyrazin-2-yl)benzamide |
|---|---|
| PubChem CID | 122559172 |
| Molecular Formula | C22H24N4O2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | N-(3,3-dimethyl-1-pyridin-3-ylbutyl)-3-(6-oxo-1H-pyrazin-2-yl)benzamide |
| SMILES | CC(C)(C)CC(NC(=O)c1cccc(-c2cncc(=O)[nH]2)c1)c1cccnc1 |
| InChI | InChI=1S/C22H24N4O2/c1-22(2,3)11-18(17-8-5-9-23-12-17)26-21(28)16-7-4-6-15(10-16)19-13-24-14-20(27)25-19/h4-10,12-14,18H,11H2,1-3H3,(H,25,27)(H,26,28) |
| InChIKey | VBXNBHMEPCZHGQ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |