C22H32N4O — CID 122561281
N-[2-(azepan-1-yl)ethyl]-3-(1-ethyl-5-methylpyrazol-4-yl)-N-methylbenzamide (PubChem CID 122561281) has the molecular formula C22H32N4O and a molecular weight of 368.53 g/mol. Its IUPAC name is N-[2-(azepan-1-yl)ethyl]-3-(1-ethyl-5-methylpyrazol-4-yl)-N-methylbenzamide.
| Compound Name | N-[2-(azepan-1-yl)ethyl]-3-(1-ethyl-5-methylpyrazol-4-yl)-N-methylbenzamide |
|---|---|
| PubChem CID | 122561281 |
| Molecular Formula | C22H32N4O |
| Molecular Weight | 368.53 g/mol |
| Exact Mass | 368.26 |
| IUPAC Name | N-[2-(azepan-1-yl)ethyl]-3-(1-ethyl-5-methylpyrazol-4-yl)-N-methylbenzamide |
| SMILES | CCn1ncc(-c2cccc(C(=O)N(C)CCN3CCCCCC3)c2)c1C |
| InChI | InChI=1S/C22H32N4O/c1-4-26-18(2)21(17-23-26)19-10-9-11-20(16-19)22(27)24(3)14-15-25-12-7-5-6-8-13-25/h9-11,16-17H,4-8,12-15H2,1-3H3 |
| InChIKey | QPOTVMBCBHYLBE-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.53 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |