C13H18N2O3S — CID 122561636
2-acetyl-N-[2-(oxan-3-yl)ethyl]-1,3-thiazole-5-carboxamide (PubChem CID 122561636) has the molecular formula C13H18N2O3S and a molecular weight of 282.36 g/mol. Its IUPAC name is 2-acetyl-N-[2-(oxan-3-yl)ethyl]-1,3-thiazole-5-carboxamide.
| Compound Name | 2-acetyl-N-[2-(oxan-3-yl)ethyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 122561636 |
| Molecular Formula | C13H18N2O3S |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 2-acetyl-N-[2-(oxan-3-yl)ethyl]-1,3-thiazole-5-carboxamide |
| SMILES | CC(=O)c1ncc(C(=O)NCCC2CCCOC2)s1 |
| InChI | InChI=1S/C13H18N2O3S/c1-9(16)13-15-7-11(19-13)12(17)14-5-4-10-3-2-6-18-8-10/h7,10H,2-6,8H2,1H3,(H,14,17) |
| InChIKey | VVBLFLKRKXQYRL-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |