C16H20N4O2 — CID 122561785
N-[2-(oxan-3-yl)ethyl]-2-(1H-1,2,4-triazol-5-yl)benzamide (PubChem CID 122561785) has the molecular formula C16H20N4O2 and a molecular weight of 300.36 g/mol. Its IUPAC name is N-[2-(oxan-3-yl)ethyl]-2-(1H-1,2,4-triazol-5-yl)benzamide.
| Compound Name | N-[2-(oxan-3-yl)ethyl]-2-(1H-1,2,4-triazol-5-yl)benzamide |
|---|---|
| PubChem CID | 122561785 |
| Molecular Formula | C16H20N4O2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | N-[2-(oxan-3-yl)ethyl]-2-(1H-1,2,4-triazol-5-yl)benzamide |
| SMILES | O=C(NCCC1CCCOC1)c1ccccc1-c1ncn[nH]1 |
| InChI | InChI=1S/C16H20N4O2/c21-16(17-8-7-12-4-3-9-22-10-12)14-6-2-1-5-13(14)15-18-11-19-20-15/h1-2,5-6,11-12H,3-4,7-10H2,(H,17,21)(H,18,19,20) |
| InChIKey | YVDASRUVGHUKEJ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |