C17H15ClN4O2 — CID 74247648
N-[2-(4-chlorophenyl)-2-hydroxyethyl]-2-(1H-1,2,4-triazol-5-yl)benzamide (PubChem CID 74247648) has the molecular formula C17H15ClN4O2 and a molecular weight of 342.79 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)-2-hydroxyethyl]-2-(1H-1,2,4-triazol-5-yl)benzamide.
| Compound Name | N-[2-(4-chlorophenyl)-2-hydroxyethyl]-2-(1H-1,2,4-triazol-5-yl)benzamide |
|---|---|
| PubChem CID | 74247648 |
| Molecular Formula | C17H15ClN4O2 |
| Molecular Weight | 342.79 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | N-[2-(4-chlorophenyl)-2-hydroxyethyl]-2-(1H-1,2,4-triazol-5-yl)benzamide |
| SMILES | O=C(NCC(O)c1ccc(Cl)cc1)c1ccccc1-c1ncn[nH]1 |
| InChI | InChI=1S/C17H15ClN4O2/c18-12-7-5-11(6-8-12)15(23)9-19-17(24)14-4-2-1-3-13(14)16-20-10-21-22-16/h1-8,10,15,23H,9H2,(H,19,24)(H,20,21,22) |
| InChIKey | MQIPFHWYCAVZFC-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.79 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |