C21H27N5O2 — CID 122561901
4-[(4-methylphenyl)methyl]-3-oxo-N-[3-(pyridin-3-ylamino)propyl]piperazine-1-carboxamide (PubChem CID 122561901) has the molecular formula C21H27N5O2 and a molecular weight of 381.48 g/mol. Its IUPAC name is 4-[(4-methylphenyl)methyl]-3-oxo-N-[3-(pyridin-3-ylamino)propyl]piperazine-1-carboxamide.
| Compound Name | 4-[(4-methylphenyl)methyl]-3-oxo-N-[3-(pyridin-3-ylamino)propyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 122561901 |
| Molecular Formula | C21H27N5O2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | 4-[(4-methylphenyl)methyl]-3-oxo-N-[3-(pyridin-3-ylamino)propyl]piperazine-1-carboxamide |
| SMILES | Cc1ccc(CN2CCN(C(=O)NCCCNc3cccnc3)CC2=O)cc1 |
| InChI | InChI=1S/C21H27N5O2/c1-17-5-7-18(8-6-17)15-25-12-13-26(16-20(25)27)21(28)24-11-3-10-23-19-4-2-9-22-14-19/h2,4-9,14,23H,3,10-13,15-16H2,1H3,(H,24,28) |
| InChIKey | YWFZLKHFGSBEMX-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|