C17H19N5O4 — CID 122563434
3-[[5-(furan-2-yl)-1,2,4-oxadiazol-3-yl]methyl]-1-methyl-1-(4,5,6,7-tetrahydro-1,2-benzoxazol-3-ylmethyl)urea (PubChem CID 122563434) has the molecular formula C17H19N5O4 and a molecular weight of 357.37 g/mol. Its IUPAC name is 3-[[5-(furan-2-yl)-1,2,4-oxadiazol-3-yl]methyl]-1-methyl-1-(4,5,6,7-tetrahydro-1,2-benzoxazol-3-ylmethyl)urea.
| Compound Name | 3-[[5-(furan-2-yl)-1,2,4-oxadiazol-3-yl]methyl]-1-methyl-1-(4,5,6,7-tetrahydro-1,2-benzoxazol-3-ylmethyl)urea |
|---|---|
| PubChem CID | 122563434 |
| Molecular Formula | C17H19N5O4 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | 3-[[5-(furan-2-yl)-1,2,4-oxadiazol-3-yl]methyl]-1-methyl-1-(4,5,6,7-tetrahydro-1,2-benzoxazol-3-ylmethyl)urea |
| SMILES | CN(Cc1noc2c1CCCC2)C(=O)NCc1noc(-c2ccco2)n1 |
| InChI | InChI=1S/C17H19N5O4/c1-22(10-12-11-5-2-3-6-13(11)25-20-12)17(23)18-9-15-19-16(26-21-15)14-7-4-8-24-14/h4,7-8H,2-3,5-6,9-10H2,1H3,(H,18,23) |
| InChIKey | ZHGUQFIBAODJPE-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 110.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |