C19H21N5O3 — CID 72887338
1-methyl-3-[4-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]-1-(4,5,6,7-tetrahydro-1,2-benzoxazol-3-ylmethyl)urea (PubChem CID 72887338) has the molecular formula C19H21N5O3 and a molecular weight of 367.41 g/mol. Its IUPAC name is 1-methyl-3-[4-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]-1-(4,5,6,7-tetrahydro-1,2-benzoxazol-3-ylmethyl)urea.
| Compound Name | 1-methyl-3-[4-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]-1-(4,5,6,7-tetrahydro-1,2-benzoxazol-3-ylmethyl)urea |
|---|---|
| PubChem CID | 72887338 |
| Molecular Formula | C19H21N5O3 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | 1-methyl-3-[4-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]-1-(4,5,6,7-tetrahydro-1,2-benzoxazol-3-ylmethyl)urea |
| SMILES | Cc1noc(-c2ccc(NC(=O)N(C)Cc3noc4c3CCCC4)cc2)n1 |
| InChI | InChI=1S/C19H21N5O3/c1-12-20-18(27-22-12)13-7-9-14(10-8-13)21-19(25)24(2)11-16-15-5-3-4-6-17(15)26-23-16/h7-10H,3-6,11H2,1-2H3,(H,21,25) |
| InChIKey | YQBQJRFOEBNFHD-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 97.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |