C20H27N3O2 — CID 122563847
4-(1-ethyl-3,5-dimethylpyrazol-4-yl)-N-(4-hydroxycyclohexyl)benzamide (PubChem CID 122563847) has the molecular formula C20H27N3O2 and a molecular weight of 341.46 g/mol. Its IUPAC name is 4-(1-ethyl-3,5-dimethylpyrazol-4-yl)-N-(4-hydroxycyclohexyl)benzamide.
| Compound Name | 4-(1-ethyl-3,5-dimethylpyrazol-4-yl)-N-(4-hydroxycyclohexyl)benzamide |
|---|---|
| PubChem CID | 122563847 |
| Molecular Formula | C20H27N3O2 |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | 4-(1-ethyl-3,5-dimethylpyrazol-4-yl)-N-(4-hydroxycyclohexyl)benzamide |
| SMILES | CCn1nc(C)c(-c2ccc(C(=O)NC3CCC(O)CC3)cc2)c1C |
| InChI | InChI=1S/C20H27N3O2/c1-4-23-14(3)19(13(2)22-23)15-5-7-16(8-6-15)20(25)21-17-9-11-18(24)12-10-17/h5-8,17-18,24H,4,9-12H2,1-3H3,(H,21,25) |
| InChIKey | OYXWJMOVMKQAKL-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |