C16H20FN3O — CID 122564098
N-[1-(2-fluorophenyl)piperidin-4-yl]-2,5-dihydro-1H-pyrrole-2-carboxamide (PubChem CID 122564098) has the molecular formula C16H20FN3O and a molecular weight of 289.35 g/mol. Its IUPAC name is N-[1-(2-fluorophenyl)piperidin-4-yl]-2,5-dihydro-1H-pyrrole-2-carboxamide.
| Compound Name | N-[1-(2-fluorophenyl)piperidin-4-yl]-2,5-dihydro-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 122564098 |
| Molecular Formula | C16H20FN3O |
| Molecular Weight | 289.35 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | N-[1-(2-fluorophenyl)piperidin-4-yl]-2,5-dihydro-1H-pyrrole-2-carboxamide |
| SMILES | O=C(NC1CCN(c2ccccc2F)CC1)C1C=CCN1 |
| InChI | InChI=1S/C16H20FN3O/c17-13-4-1-2-6-15(13)20-10-7-12(8-11-20)19-16(21)14-5-3-9-18-14/h1-6,12,14,18H,7-11H2,(H,19,21) |
| InChIKey | HTDDCAAQRQAWPI-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.35 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|