C18H24FN3O — CID 131949101
(1R,6R)-6-[[1-(2-fluorophenyl)piperidin-4-yl]amino]cyclohex-3-ene-1-carboxamide (PubChem CID 131949101) has the molecular formula C18H24FN3O and a molecular weight of 317.41 g/mol. Its IUPAC name is (1R,6R)-6-[[1-(2-fluorophenyl)piperidin-4-yl]amino]cyclohex-3-ene-1-carboxamide.
| Compound Name | (1R,6R)-6-[[1-(2-fluorophenyl)piperidin-4-yl]amino]cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 131949101 |
| Molecular Formula | C18H24FN3O |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | (1R,6R)-6-[[1-(2-fluorophenyl)piperidin-4-yl]amino]cyclohex-3-ene-1-carboxamide |
| SMILES | NC(=O)[C@@H]1CC=CC[C@H]1NC1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C18H24FN3O/c19-15-6-2-4-8-17(15)22-11-9-13(10-12-22)21-16-7-3-1-5-14(16)18(20)23/h1-4,6,8,13-14,16,21H,5,7,9-12H2,(H2,20,23)/t14-,16-/m1/s1 |
| InChIKey | JDSHZPYXYLKCMZ-GDBMZVCRSA-N |
| XLogP | 2.20 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|