C12H18N2O4S — CID 122564179
N-[(3R,4R)-3-hydroxypiperidin-4-yl]-3-methoxybenzenesulfonamide (PubChem CID 122564179) has the molecular formula C12H18N2O4S and a molecular weight of 286.35 g/mol. Its IUPAC name is N-[(3R,4R)-3-hydroxypiperidin-4-yl]-3-methoxybenzenesulfonamide.
| Compound Name | N-[(3R,4R)-3-hydroxypiperidin-4-yl]-3-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 122564179 |
| Molecular Formula | C12H18N2O4S |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | N-[(3R,4R)-3-hydroxypiperidin-4-yl]-3-methoxybenzenesulfonamide |
| SMILES | COc1cccc(S(=O)(=O)N[C@@H]2CCNC[C@H]2O)c1 |
| InChI | InChI=1S/C12H18N2O4S/c1-18-9-3-2-4-10(7-9)19(16,17)14-11-5-6-13-8-12(11)15/h2-4,7,11-15H,5-6,8H2,1H3/t11-,12-/m1/s1 |
| InChIKey | LKHJTQBGHBETQJ-VXGBXAGGSA-N |
| XLogP | -0.30 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |