C15H20ClN5O — CID 122565739
3-amino-4-chloro-N-[3-(dimethylamino)-1-phenylpropyl]-1H-pyrazole-5-carboxamide (PubChem CID 122565739) has the molecular formula C15H20ClN5O and a molecular weight of 321.81 g/mol. Its IUPAC name is 3-amino-4-chloro-N-[3-(dimethylamino)-1-phenylpropyl]-1H-pyrazole-5-carboxamide.
| Compound Name | 3-amino-4-chloro-N-[3-(dimethylamino)-1-phenylpropyl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 122565739 |
| Molecular Formula | C15H20ClN5O |
| Molecular Weight | 321.81 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | 3-amino-4-chloro-N-[3-(dimethylamino)-1-phenylpropyl]-1H-pyrazole-5-carboxamide |
| SMILES | CN(C)CCC(NC(=O)c1[nH]nc(N)c1Cl)c1ccccc1 |
| InChI | InChI=1S/C15H20ClN5O/c1-21(2)9-8-11(10-6-4-3-5-7-10)18-15(22)13-12(16)14(17)20-19-13/h3-7,11H,8-9H2,1-2H3,(H,18,22)(H3,17,19,20) |
| InChIKey | BKIYRDUBNOZPQN-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 87.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.81 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |