C15H20N4O2 — CID 122566172
N-[(1R,6R)-6-carbamoylcyclohex-3-en-1-yl]-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide (PubChem CID 122566172) has the molecular formula C15H20N4O2 and a molecular weight of 288.35 g/mol. Its IUPAC name is N-[(1R,6R)-6-carbamoylcyclohex-3-en-1-yl]-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide.
| Compound Name | N-[(1R,6R)-6-carbamoylcyclohex-3-en-1-yl]-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 122566172 |
| Molecular Formula | C15H20N4O2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | N-[(1R,6R)-6-carbamoylcyclohex-3-en-1-yl]-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide |
| SMILES | NC(=O)[C@@H]1CC=CC[C@H]1NC(=O)c1n[nH]c2c1CCCC2 |
| InChI | InChI=1S/C15H20N4O2/c16-14(20)10-6-2-3-7-11(10)17-15(21)13-9-5-1-4-8-12(9)18-19-13/h2-3,10-11H,1,4-8H2,(H2,16,20)(H,17,21)(H,18,19)/t10-,11-/m1/s1 |
| InChIKey | KIHSGUBSYBTUMQ-GHMZBOCLSA-N |
| XLogP | 0.84 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|