C19H32N4O — CID 122567299
N-(6-methylheptan-2-yl)-4-(2-methylpyrimidin-4-yl)piperidine-1-carboxamide (PubChem CID 122567299) has the molecular formula C19H32N4O and a molecular weight of 332.49 g/mol. Its IUPAC name is N-(6-methylheptan-2-yl)-4-(2-methylpyrimidin-4-yl)piperidine-1-carboxamide.
| Compound Name | N-(6-methylheptan-2-yl)-4-(2-methylpyrimidin-4-yl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 122567299 |
| Molecular Formula | C19H32N4O |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.26 |
| IUPAC Name | N-(6-methylheptan-2-yl)-4-(2-methylpyrimidin-4-yl)piperidine-1-carboxamide |
| SMILES | Cc1nccc(C2CCN(C(=O)NC(C)CCCC(C)C)CC2)n1 |
| InChI | InChI=1S/C19H32N4O/c1-14(2)6-5-7-15(3)21-19(24)23-12-9-17(10-13-23)18-8-11-20-16(4)22-18/h8,11,14-15,17H,5-7,9-10,12-13H2,1-4H3,(H,21,24) |
| InChIKey | QGNHSUJIBXWLOD-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |