About (6S)-2,6-dimethyl-8-[4-(2-methylpyrimidin-4-yl)piperidin-1-yl]octan-2-ol
(6S)-2,6-dimethyl-8-[4-(2-methylpyrimidin-4-yl)piperidin-1-yl]octan-2-ol (PubChem CID 99962057) has the molecular formula C20H35N3O
and a molecular weight of 333.52 g/mol. Its IUPAC name is (6S)-2,6-dimethyl-8-[4-(2-methylpyrimidin-4-yl)piperidin-1-yl]octan-2-ol.
Molecular Properties
| Compound Name | (6S)-2,6-dimethyl-8-[4-(2-methylpyrimidin-4-yl)piperidin-1-yl]octan-2-ol |
| PubChem CID | 99962057 |
| Molecular Formula | C20H35N3O |
| Molecular Weight | 333.52 g/mol |
| Exact Mass | 333.28 |
| IUPAC Name | (6S)-2,6-dimethyl-8-[4-(2-methylpyrimidin-4-yl)piperidin-1-yl]octan-2-ol |
| SMILES | Cc1nccc(C2CCN(CC[C@@H](C)CCCC(C)(C)O)CC2)n1 |
| InChI | InChI=1S/C20H35N3O/c1-16(6-5-11-20(3,4)24)8-13-23-14-9-18(10-15-23)19-7-12-21-17(2)22-19/h7,12,16,18,24H,5-6,8-11,13-15H2,1-4H3/t16-/m0/s1 |
| InChIKey | XHGOQMWYFJRONM-INIZCTEOSA-N |
| XLogP | 3.93 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.52 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (6S)-2,6-dimethyl-8-[4-(2-methylpyrimidin-4-yl)piperidin-1-yl]octan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6S)-2,6-dimethyl-8-[4-(2-methylpyrimidin-4-yl)piperidin-1-yl]octan-2-ol?
The IUPAC name of (6S)-2,6-dimethyl-8-[4-(2-methylpyrimidin-4-yl)piperidin-1-yl]octan-2-ol (CID 99962057) is (6S)-2,6-dimethyl-8-[4-(2-methylpyrimidin-4-yl)piperidin-1-yl]octan-2-ol.
What is the SMILES notation for (6S)-2,6-dimethyl-8-[4-(2-methylpyrimidin-4-yl)piperidin-1-yl]octan-2-ol?
The canonical SMILES for (6S)-2,6-dimethyl-8-[4-(2-methylpyrimidin-4-yl)piperidin-1-yl]octan-2-ol is Cc1nccc(C2CCN(CC[C@@H](C)CCCC(C)(C)O)CC2)n1.
What is the InChIKey of (6S)-2,6-dimethyl-8-[4-(2-methylpyrimidin-4-yl)piperidin-1-yl]octan-2-ol?
The InChIKey is XHGOQMWYFJRONM-INIZCTEOSA-N. The full InChI is InChI=1S/C20H35N3O/c1-16(6-5-11-20(3,4)24)8-13-23-14-9-18(10-15-23)19-7-12-21-17(2)22-19/h7,12,16,18,24H,5-6,8-11,13-15H2,1-4H3/t16-/m0/s1.
What are the key properties of (6S)-2,6-dimethyl-8-[4-(2-methylpyrimidin-4-yl)piperidin-1-yl]octan-2-ol?
(6S)-2,6-dimethyl-8-[4-(2-methylpyrimidin-4-yl)piperidin-1-yl]octan-2-ol has a molecular weight of 333.52 g/mol, XLogP of 3.93, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6S)-2,6-dimethyl-8-[4-(2-methylpyrimidin-4-yl)piperidin-1-yl]octan-2-ol is sourced from PubChem (CID 99962057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).