C15H18N4O4 — CID 122568183
3-[2-[3-(4-methyl-1,2,4-triazol-3-yl)propanoylamino]ethoxy]benzoic acid (PubChem CID 122568183) has the molecular formula C15H18N4O4 and a molecular weight of 318.33 g/mol. Its IUPAC name is 3-[2-[3-(4-methyl-1,2,4-triazol-3-yl)propanoylamino]ethoxy]benzoic acid.
| Compound Name | 3-[2-[3-(4-methyl-1,2,4-triazol-3-yl)propanoylamino]ethoxy]benzoic acid |
|---|---|
| PubChem CID | 122568183 |
| Molecular Formula | C15H18N4O4 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | 3-[2-[3-(4-methyl-1,2,4-triazol-3-yl)propanoylamino]ethoxy]benzoic acid |
| SMILES | Cn1cnnc1CCC(=O)NCCOc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C15H18N4O4/c1-19-10-17-18-13(19)5-6-14(20)16-7-8-23-12-4-2-3-11(9-12)15(21)22/h2-4,9-10H,5-8H2,1H3,(H,16,20)(H,21,22) |
| InChIKey | XUZXQRZEWOCBAY-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|