C16H19N3O6S — CID 167930854
3-[2-[[2-(3,5-dimethyl-1,1-dioxo-1,2,6-thiadiazin-2-yl)acetyl]amino]ethoxy]benzoic acid (PubChem CID 167930854) has the molecular formula C16H19N3O6S and a molecular weight of 381.41 g/mol. Its IUPAC name is 3-[2-[[2-(3,5-dimethyl-1,1-dioxo-1,2,6-thiadiazin-2-yl)acetyl]amino]ethoxy]benzoic acid.
| Compound Name | 3-[2-[[2-(3,5-dimethyl-1,1-dioxo-1,2,6-thiadiazin-2-yl)acetyl]amino]ethoxy]benzoic acid |
|---|---|
| PubChem CID | 167930854 |
| Molecular Formula | C16H19N3O6S |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | 3-[2-[[2-(3,5-dimethyl-1,1-dioxo-1,2,6-thiadiazin-2-yl)acetyl]amino]ethoxy]benzoic acid |
| SMILES | CC1=CC(C)=NS(=O)(=O)N1CC(=O)NCCOc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C16H19N3O6S/c1-11-8-12(2)19(26(23,24)18-11)10-15(20)17-6-7-25-14-5-3-4-13(9-14)16(21)22/h3-5,8-9H,6-7,10H2,1-2H3,(H,17,20)(H,21,22) |
| InChIKey | UNYPPARUKWWKIJ-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 125.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|