C14H27N3OS2 — CID 122569116
1-[3-(1,4-dithiepan-6-ylamino)propyl]piperidine-4-carboxamide (PubChem CID 122569116) has the molecular formula C14H27N3OS2 and a molecular weight of 317.52 g/mol. Its IUPAC name is 1-[3-(1,4-dithiepan-6-ylamino)propyl]piperidine-4-carboxamide.
| Compound Name | 1-[3-(1,4-dithiepan-6-ylamino)propyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 122569116 |
| Molecular Formula | C14H27N3OS2 |
| Molecular Weight | 317.52 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | 1-[3-(1,4-dithiepan-6-ylamino)propyl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(CCCNC2CSCCSC2)CC1 |
| InChI | InChI=1S/C14H27N3OS2/c15-14(18)12-2-6-17(7-3-12)5-1-4-16-13-10-19-8-9-20-11-13/h12-13,16H,1-11H2,(H2,15,18) |
| InChIKey | ORTGHKKDVFXBJD-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.52 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|