C13H23F3N4O2 — CID 56796177
1-[4-(2,2,2-trifluoroethylcarbamoylamino)butyl]piperidine-4-carboxamide (PubChem CID 56796177) has the molecular formula C13H23F3N4O2 and a molecular weight of 324.35 g/mol. Its IUPAC name is 1-[4-(2,2,2-trifluoroethylcarbamoylamino)butyl]piperidine-4-carboxamide.
| Compound Name | 1-[4-(2,2,2-trifluoroethylcarbamoylamino)butyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 56796177 |
| Molecular Formula | C13H23F3N4O2 |
| Molecular Weight | 324.35 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | 1-[4-(2,2,2-trifluoroethylcarbamoylamino)butyl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(CCCCNC(=O)NCC(F)(F)F)CC1 |
| InChI | InChI=1S/C13H23F3N4O2/c14-13(15,16)9-19-12(22)18-5-1-2-6-20-7-3-10(4-8-20)11(17)21/h10H,1-9H2,(H2,17,21)(H2,18,19,22) |
| InChIKey | PVCQUSAYGSYSBJ-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.35 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|