C23H29FN4O3 — CID 86899172
1-[4-[(2-fluoro-6-phenoxyphenyl)carbamoylamino]butyl]piperidine-4-carboxamide (PubChem CID 86899172) has the molecular formula C23H29FN4O3 and a molecular weight of 428.51 g/mol. Its IUPAC name is 1-[4-[(2-fluoro-6-phenoxyphenyl)carbamoylamino]butyl]piperidine-4-carboxamide.
| Compound Name | 1-[4-[(2-fluoro-6-phenoxyphenyl)carbamoylamino]butyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 86899172 |
| Molecular Formula | C23H29FN4O3 |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | 1-[4-[(2-fluoro-6-phenoxyphenyl)carbamoylamino]butyl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(CCCCNC(=O)Nc2c(F)cccc2Oc2ccccc2)CC1 |
| InChI | InChI=1S/C23H29FN4O3/c24-19-9-6-10-20(31-18-7-2-1-3-8-18)21(19)27-23(30)26-13-4-5-14-28-15-11-17(12-16-28)22(25)29/h1-3,6-10,17H,4-5,11-16H2,(H2,25,29)(H2,26,27,30) |
| InChIKey | VSMIKHPTGOZIIA-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|