C15H27N3O3 — CID 122569135
3,5-dimethyl-N-[3-(1-methylpiperidin-4-yl)oxypropyl]-4H-1,2-oxazole-5-carboxamide (PubChem CID 122569135) has the molecular formula C15H27N3O3 and a molecular weight of 297.40 g/mol. Its IUPAC name is 3,5-dimethyl-N-[3-(1-methylpiperidin-4-yl)oxypropyl]-4H-1,2-oxazole-5-carboxamide.
| Compound Name | 3,5-dimethyl-N-[3-(1-methylpiperidin-4-yl)oxypropyl]-4H-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 122569135 |
| Molecular Formula | C15H27N3O3 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | 3,5-dimethyl-N-[3-(1-methylpiperidin-4-yl)oxypropyl]-4H-1,2-oxazole-5-carboxamide |
| SMILES | CC1=NOC(C)(C(=O)NCCCOC2CCN(C)CC2)C1 |
| InChI | InChI=1S/C15H27N3O3/c1-12-11-15(2,21-17-12)14(19)16-7-4-10-20-13-5-8-18(3)9-6-13/h13H,4-11H2,1-3H3,(H,16,19) |
| InChIKey | FFLPJVWLXAIZPL-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|